About 6,7-bis(methoxysulfanyl)-2,3-dihydrochromen-4-one
6,7-bis(methoxysulfanyl)-2,3-dihydrochromen-4-one (PubChem CID 57234506) has the molecular formula C11H12O4S2
and a molecular weight of 272.35 g/mol. Its IUPAC name is 6,7-bis(methoxysulfanyl)-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 6,7-bis(methoxysulfanyl)-2,3-dihydrochromen-4-one |
| PubChem CID | 57234506 |
| Molecular Formula | C11H12O4S2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 6,7-bis(methoxysulfanyl)-2,3-dihydrochromen-4-one |
| SMILES | COSc1cc2c(cc1SOC)C(=O)CCO2 |
| InChI | InChI=1S/C11H12O4S2/c1-13-16-10-5-7-8(12)3-4-15-9(7)6-11(10)17-14-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | HEINTYQKMRMAHC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6,7-bis(methoxysulfanyl)-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-bis(methoxysulfanyl)-2,3-dihydrochromen-4-one?
The IUPAC name of 6,7-bis(methoxysulfanyl)-2,3-dihydrochromen-4-one (CID 57234506) is 6,7-bis(methoxysulfanyl)-2,3-dihydrochromen-4-one.
What is the SMILES notation for 6,7-bis(methoxysulfanyl)-2,3-dihydrochromen-4-one?
The canonical SMILES for 6,7-bis(methoxysulfanyl)-2,3-dihydrochromen-4-one is COSc1cc2c(cc1SOC)C(=O)CCO2.
What is the InChIKey of 6,7-bis(methoxysulfanyl)-2,3-dihydrochromen-4-one?
The InChIKey is HEINTYQKMRMAHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O4S2/c1-13-16-10-5-7-8(12)3-4-15-9(7)6-11(10)17-14-2/h5-6H,3-4H2,1-2H3.
What are the key properties of 6,7-bis(methoxysulfanyl)-2,3-dihydrochromen-4-one?
6,7-bis(methoxysulfanyl)-2,3-dihydrochromen-4-one has a molecular weight of 272.35 g/mol, XLogP of 2.96, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-bis(methoxysulfanyl)-2,3-dihydrochromen-4-one is sourced from PubChem (CID 57234506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).