About 6,8-bis(butylsulfanyl)-3,4-dihydro-2H-chromene-4-carboxylic acid
6,8-bis(butylsulfanyl)-3,4-dihydro-2H-chromene-4-carboxylic acid (PubChem CID 57235349) has the molecular formula C18H26O3S2
and a molecular weight of 354.54 g/mol. Its IUPAC name is 6,8-bis(butylsulfanyl)-3,4-dihydro-2H-chromene-4-carboxylic acid.
Molecular Properties
| Compound Name | 6,8-bis(butylsulfanyl)-3,4-dihydro-2H-chromene-4-carboxylic acid |
| PubChem CID | 57235349 |
| Molecular Formula | C18H26O3S2 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 6,8-bis(butylsulfanyl)-3,4-dihydro-2H-chromene-4-carboxylic acid |
| SMILES | CCCCSc1cc(SCCCC)c2c(c1)C(C(=O)O)CCO2 |
| InChI | InChI=1S/C18H26O3S2/c1-3-5-9-22-13-11-15-14(18(19)20)7-8-21-17(15)16(12-13)23-10-6-4-2/h11-12,14H,3-10H2,1-2H3,(H,19,20) |
| InChIKey | LONHYELXQIONKI-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6,8-bis(butylsulfanyl)-3,4-dihydro-2H-chromene-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-bis(butylsulfanyl)-3,4-dihydro-2H-chromene-4-carboxylic acid?
The IUPAC name of 6,8-bis(butylsulfanyl)-3,4-dihydro-2H-chromene-4-carboxylic acid (CID 57235349) is 6,8-bis(butylsulfanyl)-3,4-dihydro-2H-chromene-4-carboxylic acid.
What is the SMILES notation for 6,8-bis(butylsulfanyl)-3,4-dihydro-2H-chromene-4-carboxylic acid?
The canonical SMILES for 6,8-bis(butylsulfanyl)-3,4-dihydro-2H-chromene-4-carboxylic acid is CCCCSc1cc(SCCCC)c2c(c1)C(C(=O)O)CCO2.
What is the InChIKey of 6,8-bis(butylsulfanyl)-3,4-dihydro-2H-chromene-4-carboxylic acid?
The InChIKey is LONHYELXQIONKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O3S2/c1-3-5-9-22-13-11-15-14(18(19)20)7-8-21-17(15)16(12-13)23-10-6-4-2/h11-12,14H,3-10H2,1-2H3,(H,19,20).
What are the key properties of 6,8-bis(butylsulfanyl)-3,4-dihydro-2H-chromene-4-carboxylic acid?
6,8-bis(butylsulfanyl)-3,4-dihydro-2H-chromene-4-carboxylic acid has a molecular weight of 354.54 g/mol, XLogP of 5.42, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-bis(butylsulfanyl)-3,4-dihydro-2H-chromene-4-carboxylic acid is sourced from PubChem (CID 57235349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).