C15H17BrN2O5S — CID 57235712
(2S,5R)-6-bromo-6-[2-hydroxy-2-(1-methylpyrrol-2-yl)acetyl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 57235712) has the molecular formula C15H17BrN2O5S and a molecular weight of 417.28 g/mol. Its IUPAC name is (2S,5R)-6-bromo-6-[2-hydroxy-2-(1-methylpyrrol-2-yl)acetyl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R)-6-bromo-6-[2-hydroxy-2-(1-methylpyrrol-2-yl)acetyl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 57235712 |
| Molecular Formula | C15H17BrN2O5S |
| Molecular Weight | 417.28 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | (2S,5R)-6-bromo-6-[2-hydroxy-2-(1-methylpyrrol-2-yl)acetyl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | Cn1cccc1C(O)C(=O)C1(Br)C(=O)N2[C@@H](C(=O)O)C(C)(C)S[C@@H]21 |
| InChI | InChI=1S/C15H17BrN2O5S/c1-14(2)9(11(21)22)18-12(23)15(16,13(18)24-14)10(20)8(19)7-5-4-6-17(7)3/h4-6,8-9,13,19H,1-3H3,(H,21,22)/t8?,9-,13+,15?/m0/s1 |
| InChIKey | DYDBOOONIFXBON-OKVLQIECSA-N |
| XLogP | 0.91 |
| TPSA | 99.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|