About 8,8-bis(4-fluorophenyl)-4-phenyloctane-1,5-diamine
8,8-bis(4-fluorophenyl)-4-phenyloctane-1,5-diamine (PubChem CID 57235740) has the molecular formula C26H30F2N2
and a molecular weight of 408.54 g/mol. Its IUPAC name is 8,8-bis(4-fluorophenyl)-4-phenyloctane-1,5-diamine.
Molecular Properties
| Compound Name | 8,8-bis(4-fluorophenyl)-4-phenyloctane-1,5-diamine |
| PubChem CID | 57235740 |
| Molecular Formula | C26H30F2N2 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 8,8-bis(4-fluorophenyl)-4-phenyloctane-1,5-diamine |
| SMILES | NCCCC(c1ccccc1)C(N)CCC(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H30F2N2/c27-22-12-8-20(9-13-22)24(21-10-14-23(28)15-11-21)16-17-26(30)25(7-4-18-29)19-5-2-1-3-6-19/h1-3,5-6,8-15,24-26H,4,7,16-18,29-30H2 |
| InChIKey | NFQNHMMYCQFQGB-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8,8-bis(4-fluorophenyl)-4-phenyloctane-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-bis(4-fluorophenyl)-4-phenyloctane-1,5-diamine?
The IUPAC name of 8,8-bis(4-fluorophenyl)-4-phenyloctane-1,5-diamine (CID 57235740) is 8,8-bis(4-fluorophenyl)-4-phenyloctane-1,5-diamine.
What is the SMILES notation for 8,8-bis(4-fluorophenyl)-4-phenyloctane-1,5-diamine?
The canonical SMILES for 8,8-bis(4-fluorophenyl)-4-phenyloctane-1,5-diamine is NCCCC(c1ccccc1)C(N)CCC(c1ccc(F)cc1)c1ccc(F)cc1.
What is the InChIKey of 8,8-bis(4-fluorophenyl)-4-phenyloctane-1,5-diamine?
The InChIKey is NFQNHMMYCQFQGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30F2N2/c27-22-12-8-20(9-13-22)24(21-10-14-23(28)15-11-21)16-17-26(30)25(7-4-18-29)19-5-2-1-3-6-19/h1-3,5-6,8-15,24-26H,4,7,16-18,29-30H2.
What are the key properties of 8,8-bis(4-fluorophenyl)-4-phenyloctane-1,5-diamine?
8,8-bis(4-fluorophenyl)-4-phenyloctane-1,5-diamine has a molecular weight of 408.54 g/mol, XLogP of 5.73, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-bis(4-fluorophenyl)-4-phenyloctane-1,5-diamine is sourced from PubChem (CID 57235740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).