C20H19N5O2 — CID 57236283
2-cyano-1-[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-1-phenylguanidine (PubChem CID 57236283) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is 2-cyano-1-[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-1-phenylguanidine.
| Compound Name | 2-cyano-1-[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-1-phenylguanidine |
|---|---|
| PubChem CID | 57236283 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 2-cyano-1-[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-1-phenylguanidine |
| SMILES | CC1(C)Oc2ccc(C#N)cc2[C@@H](N(/C(N)=N/C#N)c2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C20H19N5O2/c1-20(2)18(26)17(15-10-13(11-21)8-9-16(15)27-20)25(19(23)24-12-22)14-6-4-3-5-7-14/h3-10,17-18,26H,1-2H3,(H2,23,24)/t17-,18+/m1/s1 |
| InChIKey | ZYWQRDFMTRWTLT-MSOLQXFVSA-N |
| XLogP | 2.43 |
| TPSA | 118.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|