C29H54O3Si2 — CID 57236312
(3aS,5R,6S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalene-2-carbaldehyde (PubChem CID 57236312) has the molecular formula C29H54O3Si2 and a molecular weight of 506.92 g/mol. Its IUPAC name is (3aS,5R,6S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalene-2-carbaldehyde.
| Compound Name | (3aS,5R,6S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalene-2-carbaldehyde |
|---|---|
| PubChem CID | 57236312 |
| Molecular Formula | C29H54O3Si2 |
| Molecular Weight | 506.92 g/mol |
| Exact Mass | 506.36 |
| IUPAC Name | (3aS,5R,6S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalene-2-carbaldehyde |
| SMILES | CCCCC[C@@H](C=C[C@H]1[C@H]2CC(C=O)=C[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H54O3Si2/c1-12-13-14-15-24(31-33(8,9)28(2,3)4)16-17-25-26-19-22(21-30)18-23(26)20-27(25)32-34(10,11)29(5,6)7/h16-18,21,23-27H,12-15,19-20H2,1-11H3/t23-,24-,25-,26-,27+/m0/s1 |
| InChIKey | SIGACRXYBGJRBE-JSLVBRCRSA-N |
| XLogP | 8.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.92 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|