C17H18F2N2O4S — CID 57237043
N-[[3-[4-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)-3,5-difluorophenyl]-2,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide (PubChem CID 57237043) has the molecular formula C17H18F2N2O4S and a molecular weight of 384.40 g/mol. Its IUPAC name is N-[[3-[4-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)-3,5-difluorophenyl]-2,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[4-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)-3,5-difluorophenyl]-2,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 57237043 |
| Molecular Formula | C17H18F2N2O4S |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | N-[[3-[4-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)-3,5-difluorophenyl]-2,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1C=C(c2cc(F)c(C3=CCS(=O)(=O)CC3)c(F)c2)NO1 |
| InChI | InChI=1S/C17H18F2N2O4S/c1-10(22)20-9-13-8-16(21-25-13)12-6-14(18)17(15(19)7-12)11-2-4-26(23,24)5-3-11/h2,6-8,13,21H,3-5,9H2,1H3,(H,20,22) |
| InChIKey | XWIHXKKLPVFNIS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |