C40H50N2O8+2 — CID 57237141
2,4-bis[1-[(2,5-dimethoxyphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl]benzene-1,3-dicarboxylic acid (PubChem CID 57237141) has the molecular formula C40H50N2O8+2 and a molecular weight of 686.85 g/mol. Its IUPAC name is 2,4-bis[1-[(2,5-dimethoxyphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 2,4-bis[1-[(2,5-dimethoxyphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 57237141 |
| Molecular Formula | C40H50N2O8+2 |
| Molecular Weight | 686.85 g/mol |
| Exact Mass | 686.36 |
| IUPAC Name | 2,4-bis[1-[(2,5-dimethoxyphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl]benzene-1,3-dicarboxylic acid |
| SMILES | COc1ccc(OC)c(C[N+]23CCC(CC2)C(c2ccc(C(=O)O)c(C4C[N+]5(Cc6cc(OC)ccc6OC)CCC4CC5)c2C(=O)O)C3)c1 |
| InChI | InChI=1S/C40H48N2O8/c1-47-29-5-9-35(49-3)27(19-29)21-41-15-11-25(12-16-41)33(23-41)31-7-8-32(39(43)44)37(38(31)40(45)46)34-24-42(17-13-26(34)14-18-42)22-28-20-30(48-2)6-10-36(28)50-4/h5-10,19-20,25-26,33-34H,11-18,21-24H2,1-4H3/p+2 |
| InChIKey | QXRSRVRBZRPNNY-UHFFFAOYSA-P |
| XLogP | 6.17 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.85 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|