C21H40N4S2 — CID 57237204
6-(octadec-9-enylamino)-3-sulfanyl-1,4-dihydro-1,3,5-triazine-2-thione (PubChem CID 57237204) has the molecular formula C21H40N4S2 and a molecular weight of 412.71 g/mol. Its IUPAC name is 6-(octadec-9-enylamino)-3-sulfanyl-1,4-dihydro-1,3,5-triazine-2-thione.
| Compound Name | 6-(octadec-9-enylamino)-3-sulfanyl-1,4-dihydro-1,3,5-triazine-2-thione |
|---|---|
| PubChem CID | 57237204 |
| Molecular Formula | C21H40N4S2 |
| Molecular Weight | 412.71 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | 6-(octadec-9-enylamino)-3-sulfanyl-1,4-dihydro-1,3,5-triazine-2-thione |
| SMILES | CCCCCCCCC=CCCCCCCCCNC1=NCN(S)C(=S)N1 |
| InChI | InChI=1S/C21H40N4S2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-20-23-19-25(27)21(26)24-20/h9-10,27H,2-8,11-19H2,1H3,(H2,22,23,24,26) |
| InChIKey | JAFSAALZRANVDN-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.71 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|