C12H10F3NOS2 — CID 57237231
S-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl] butanethioate (PubChem CID 57237231) has the molecular formula C12H10F3NOS2 and a molecular weight of 305.35 g/mol. Its IUPAC name is S-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl] butanethioate.
| Compound Name | S-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl] butanethioate |
|---|---|
| PubChem CID | 57237231 |
| Molecular Formula | C12H10F3NOS2 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | S-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl] butanethioate |
| SMILES | CCCC(=O)Sc1nc2cc(C(F)(F)F)ccc2s1 |
| InChI | InChI=1S/C12H10F3NOS2/c1-2-3-10(17)19-11-16-8-6-7(12(13,14)15)4-5-9(8)18-11/h4-6H,2-3H2,1H3 |
| InChIKey | SWPUMHRFDRIFRE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|