C14H30Cl2N2 — CID 57237258
5-chloro-1-N-(2-chloroethyl)-4-N,4-N-diethyl-1-N-propan-2-ylpentane-1,4-diamine (PubChem CID 57237258) has the molecular formula C14H30Cl2N2 and a molecular weight of 297.31 g/mol. Its IUPAC name is 5-chloro-1-N-(2-chloroethyl)-4-N,4-N-diethyl-1-N-propan-2-ylpentane-1,4-diamine.
| Compound Name | 5-chloro-1-N-(2-chloroethyl)-4-N,4-N-diethyl-1-N-propan-2-ylpentane-1,4-diamine |
|---|---|
| PubChem CID | 57237258 |
| Molecular Formula | C14H30Cl2N2 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 5-chloro-1-N-(2-chloroethyl)-4-N,4-N-diethyl-1-N-propan-2-ylpentane-1,4-diamine |
| SMILES | CCN(CC)C(CCl)CCCN(CCCl)C(C)C |
| InChI | InChI=1S/C14H30Cl2N2/c1-5-17(6-2)14(12-16)8-7-10-18(11-9-15)13(3)4/h13-14H,5-12H2,1-4H3 |
| InChIKey | BVEXHMGHSUXWLL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|