About 3-amino-1,2-dihydroimidazol-3-ium-5-one
3-amino-1,2-dihydroimidazol-3-ium-5-one (PubChem CID 57238026) has the molecular formula C3H6N3O+
and a molecular weight of 100.10 g/mol. Its IUPAC name is 3-amino-1,2-dihydroimidazol-3-ium-5-one.
Molecular Properties
| Compound Name | 3-amino-1,2-dihydroimidazol-3-ium-5-one |
| PubChem CID | 57238026 |
| Molecular Formula | C3H6N3O+ |
| Molecular Weight | 100.10 g/mol |
| Exact Mass | 100.05 |
| IUPAC Name | 3-amino-1,2-dihydroimidazol-3-ium-5-one |
| SMILES | N[N+]1=CC(=O)NC1 |
| InChI | InChI=1S/C3H5N3O/c4-6-1-3(7)5-2-6/h1H,2H2,(H2-,4,5,7)/p+1 |
| InChIKey | BPDUNWJYTBVALI-UHFFFAOYSA-O |
| XLogP | -1.97 |
| TPSA | 58.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.10 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-1,2-dihydroimidazol-3-ium-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1,2-dihydroimidazol-3-ium-5-one?
The IUPAC name of 3-amino-1,2-dihydroimidazol-3-ium-5-one (CID 57238026) is 3-amino-1,2-dihydroimidazol-3-ium-5-one.
What is the SMILES notation for 3-amino-1,2-dihydroimidazol-3-ium-5-one?
The canonical SMILES for 3-amino-1,2-dihydroimidazol-3-ium-5-one is N[N+]1=CC(=O)NC1.
What is the InChIKey of 3-amino-1,2-dihydroimidazol-3-ium-5-one?
The InChIKey is BPDUNWJYTBVALI-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H5N3O/c4-6-1-3(7)5-2-6/h1H,2H2,(H2-,4,5,7)/p+1.
What are the key properties of 3-amino-1,2-dihydroimidazol-3-ium-5-one?
3-amino-1,2-dihydroimidazol-3-ium-5-one has a molecular weight of 100.10 g/mol, XLogP of -1.97, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1,2-dihydroimidazol-3-ium-5-one is sourced from PubChem (CID 57238026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).