About 6-imino-7,8-dihydro-5H-naphthalen-1-amine
6-imino-7,8-dihydro-5H-naphthalen-1-amine (PubChem CID 57238586) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 6-imino-7,8-dihydro-5H-naphthalen-1-amine.
Molecular Properties
| Compound Name | 6-imino-7,8-dihydro-5H-naphthalen-1-amine |
| PubChem CID | 57238586 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 6-imino-7,8-dihydro-5H-naphthalen-1-amine |
| SMILES | [H]/N=C1\CCc2c(N)cccc2C1 |
| InChI | InChI=1S/C10H12N2/c11-8-4-5-9-7(6-8)2-1-3-10(9)12/h1-3,11H,4-6,12H2/b11-8+ |
| InChIKey | HTXNDTFBWOYVBK-DHZHZOJOSA-N |
| XLogP | 1.78 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-imino-7,8-dihydro-5H-naphthalen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-imino-7,8-dihydro-5H-naphthalen-1-amine?
The IUPAC name of 6-imino-7,8-dihydro-5H-naphthalen-1-amine (CID 57238586) is 6-imino-7,8-dihydro-5H-naphthalen-1-amine.
What is the SMILES notation for 6-imino-7,8-dihydro-5H-naphthalen-1-amine?
The canonical SMILES for 6-imino-7,8-dihydro-5H-naphthalen-1-amine is [H]/N=C1\CCc2c(N)cccc2C1.
What is the InChIKey of 6-imino-7,8-dihydro-5H-naphthalen-1-amine?
The InChIKey is HTXNDTFBWOYVBK-DHZHZOJOSA-N. The full InChI is InChI=1S/C10H12N2/c11-8-4-5-9-7(6-8)2-1-3-10(9)12/h1-3,11H,4-6,12H2/b11-8+.
What are the key properties of 6-imino-7,8-dihydro-5H-naphthalen-1-amine?
6-imino-7,8-dihydro-5H-naphthalen-1-amine has a molecular weight of 160.22 g/mol, XLogP of 1.78, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-imino-7,8-dihydro-5H-naphthalen-1-amine is sourced from PubChem (CID 57238586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).