C35H46F3NO — CID 57238819
N-methyl-3-phenyl-N-propyl-3-[4-(trifluoromethyl)phenyl]octadeca-6,9,12-trienamide (PubChem CID 57238819) has the molecular formula C35H46F3NO and a molecular weight of 553.75 g/mol. Its IUPAC name is N-methyl-3-phenyl-N-propyl-3-[4-(trifluoromethyl)phenyl]octadeca-6,9,12-trienamide.
| Compound Name | N-methyl-3-phenyl-N-propyl-3-[4-(trifluoromethyl)phenyl]octadeca-6,9,12-trienamide |
|---|---|
| PubChem CID | 57238819 |
| Molecular Formula | C35H46F3NO |
| Molecular Weight | 553.75 g/mol |
| Exact Mass | 553.35 |
| IUPAC Name | N-methyl-3-phenyl-N-propyl-3-[4-(trifluoromethyl)phenyl]octadeca-6,9,12-trienamide |
| SMILES | CCCCCC=CCC=CCC=CCCC(CC(=O)N(C)CCC)(c1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C35H46F3NO/c1-4-6-7-8-9-10-11-12-13-14-15-16-20-27-34(30-21-18-17-19-22-30,29-33(40)39(3)28-5-2)31-23-25-32(26-24-31)35(36,37)38/h9-10,12-13,15-19,21-26H,4-8,11,14,20,27-29H2,1-3H3 |
| InChIKey | QSBPUGYWWAQIJK-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.75 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|