C22H20Cl4F3NO4 — CID 57238915
1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-2-[5-[4-(2,2,2-trifluoro-1-nitrosoethyl)phenoxy]pentoxy]benzene (PubChem CID 57238915) has the molecular formula C22H20Cl4F3NO4 and a molecular weight of 561.21 g/mol. Its IUPAC name is 1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-2-[5-[4-(2,2,2-trifluoro-1-nitrosoethyl)phenoxy]pentoxy]benzene.
| Compound Name | 1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-2-[5-[4-(2,2,2-trifluoro-1-nitrosoethyl)phenoxy]pentoxy]benzene |
|---|---|
| PubChem CID | 57238915 |
| Molecular Formula | C22H20Cl4F3NO4 |
| Molecular Weight | 561.21 g/mol |
| Exact Mass | 559.01 |
| IUPAC Name | 1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-2-[5-[4-(2,2,2-trifluoro-1-nitrosoethyl)phenoxy]pentoxy]benzene |
| SMILES | O=NC(c1ccc(OCCCCCOc2c(Cl)cc(OCC=C(Cl)Cl)cc2Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C22H20Cl4F3NO4/c23-17-12-16(33-11-8-19(25)26)13-18(24)20(17)34-10-3-1-2-9-32-15-6-4-14(5-7-15)21(30-31)22(27,28)29/h4-8,12-13,21H,1-3,9-11H2 |
| InChIKey | INRVUGGZKACDDK-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.21 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|