C28H8F20P2 — CID 57239596
[(2S,3S)-3-bis(2,3,4,5,6-pentafluorophenyl)phosphanylbutan-2-yl]-bis(2,3,4,5,6-pentafluorophenyl)phosphane (PubChem CID 57239596) has the molecular formula C28H8F20P2 and a molecular weight of 786.28 g/mol. Its IUPAC name is [(2S,3S)-3-bis(2,3,4,5,6-pentafluorophenyl)phosphanylbutan-2-yl]-bis(2,3,4,5,6-pentafluorophenyl)phosphane.
| Compound Name | [(2S,3S)-3-bis(2,3,4,5,6-pentafluorophenyl)phosphanylbutan-2-yl]-bis(2,3,4,5,6-pentafluorophenyl)phosphane |
|---|---|
| PubChem CID | 57239596 |
| Molecular Formula | C28H8F20P2 |
| Molecular Weight | 786.28 g/mol |
| Exact Mass | 785.98 |
| IUPAC Name | [(2S,3S)-3-bis(2,3,4,5,6-pentafluorophenyl)phosphanylbutan-2-yl]-bis(2,3,4,5,6-pentafluorophenyl)phosphane |
| SMILES | C[C@@H]([C@H](C)P(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F)P(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C28H8F20P2/c1-3(49(25-17(41)9(33)5(29)10(34)18(25)42)26-19(43)11(35)6(30)12(36)20(26)44)4(2)50(27-21(45)13(37)7(31)14(38)22(27)46)28-23(47)15(39)8(32)16(40)24(28)48/h3-4H,1-2H3/t3-,4-/m0/s1 |
| InChIKey | YAXVZFZGHDXVQO-IMJSIDKUSA-N |
| XLogP | 8.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.28 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|