C17H24O10 — CID 57239639
[(2R,3S,4S,5S)-4,5-diacetyl-5-acetyloxy-1,2,3-trihydroxy-6-oxonon-8-en-4-yl] acetate (PubChem CID 57239639) has the molecular formula C17H24O10 and a molecular weight of 388.37 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-4,5-diacetyl-5-acetyloxy-1,2,3-trihydroxy-6-oxonon-8-en-4-yl] acetate.
| Compound Name | [(2R,3S,4S,5S)-4,5-diacetyl-5-acetyloxy-1,2,3-trihydroxy-6-oxonon-8-en-4-yl] acetate |
|---|---|
| PubChem CID | 57239639 |
| Molecular Formula | C17H24O10 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | [(2R,3S,4S,5S)-4,5-diacetyl-5-acetyloxy-1,2,3-trihydroxy-6-oxonon-8-en-4-yl] acetate |
| SMILES | C=CCC(=O)[C@@](OC(C)=O)(C(C)=O)[C@](OC(C)=O)(C(C)=O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C17H24O10/c1-6-7-14(24)16(9(2)19,26-11(4)21)17(10(3)20,27-12(5)22)15(25)13(23)8-18/h6,13,15,18,23,25H,1,7-8H2,2-5H3/t13-,15+,16+,17+/m1/s1 |
| InChIKey | DPHOJXPIUHNESA-IWCQGFGOSA-N |
| XLogP | -1.37 |
| TPSA | 164.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|