C29H42O6 — CID 57240011
[(8S,9S,10R,13S,14S,17S)-17-acetyl-16-butanoyloxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,17-decahydro-1H-cyclopenta[a]phenanthren-16-yl] butanoate (PubChem CID 57240011) has the molecular formula C29H42O6 and a molecular weight of 486.65 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S,17S)-17-acetyl-16-butanoyloxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,17-decahydro-1H-cyclopenta[a]phenanthren-16-yl] butanoate.
| Compound Name | [(8S,9S,10R,13S,14S,17S)-17-acetyl-16-butanoyloxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,17-decahydro-1H-cyclopenta[a]phenanthren-16-yl] butanoate |
|---|---|
| PubChem CID | 57240011 |
| Molecular Formula | C29H42O6 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | [(8S,9S,10R,13S,14S,17S)-17-acetyl-16-butanoyloxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,17-decahydro-1H-cyclopenta[a]phenanthren-16-yl] butanoate |
| SMILES | CCCC(=O)OC1(OC(=O)CCC)C[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]2(C)[C@H]1C(C)=O |
| InChI | InChI=1S/C29H42O6/c1-6-8-24(32)34-29(35-25(33)9-7-2)17-23-21-11-10-19-16-20(31)12-14-27(19,4)22(21)13-15-28(23,5)26(29)18(3)30/h16,21-23,26H,6-15,17H2,1-5H3/t21-,22+,23+,26-,27+,28+/m1/s1 |
| InChIKey | LPPXAONTSVYLQU-ORZTVLAMSA-N |
| XLogP | 5.72 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|