About 3'-[3-(trifluoromethyl)phenyl]spiro[2-benzofuran-3,5'-2H-1,2-oxazole]-1-one
3'-[3-(trifluoromethyl)phenyl]spiro[2-benzofuran-3,5'-2H-1,2-oxazole]-1-one (PubChem CID 57240150) has the molecular formula C17H10F3NO3
and a molecular weight of 333.27 g/mol. Its IUPAC name is 3'-[3-(trifluoromethyl)phenyl]spiro[2-benzofuran-3,5'-2H-1,2-oxazole]-1-one.
Molecular Properties
| Compound Name | 3'-[3-(trifluoromethyl)phenyl]spiro[2-benzofuran-3,5'-2H-1,2-oxazole]-1-one |
| PubChem CID | 57240150 |
| Molecular Formula | C17H10F3NO3 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 3'-[3-(trifluoromethyl)phenyl]spiro[2-benzofuran-3,5'-2H-1,2-oxazole]-1-one |
| SMILES | O=C1OC2(C=C(c3cccc(C(F)(F)F)c3)NO2)c2ccccc21 |
| InChI | InChI=1S/C17H10F3NO3/c18-17(19,20)11-5-3-4-10(8-11)14-9-16(24-21-14)13-7-2-1-6-12(13)15(22)23-16/h1-9,21H |
| InChIKey | MVMQGYJZNRWFDK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3'-[3-(trifluoromethyl)phenyl]spiro[2-benzofuran-3,5'-2H-1,2-oxazole]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-[3-(trifluoromethyl)phenyl]spiro[2-benzofuran-3,5'-2H-1,2-oxazole]-1-one?
The IUPAC name of 3'-[3-(trifluoromethyl)phenyl]spiro[2-benzofuran-3,5'-2H-1,2-oxazole]-1-one (CID 57240150) is 3'-[3-(trifluoromethyl)phenyl]spiro[2-benzofuran-3,5'-2H-1,2-oxazole]-1-one.
What is the SMILES notation for 3'-[3-(trifluoromethyl)phenyl]spiro[2-benzofuran-3,5'-2H-1,2-oxazole]-1-one?
The canonical SMILES for 3'-[3-(trifluoromethyl)phenyl]spiro[2-benzofuran-3,5'-2H-1,2-oxazole]-1-one is O=C1OC2(C=C(c3cccc(C(F)(F)F)c3)NO2)c2ccccc21.
What is the InChIKey of 3'-[3-(trifluoromethyl)phenyl]spiro[2-benzofuran-3,5'-2H-1,2-oxazole]-1-one?
The InChIKey is MVMQGYJZNRWFDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10F3NO3/c18-17(19,20)11-5-3-4-10(8-11)14-9-16(24-21-14)13-7-2-1-6-12(13)15(22)23-16/h1-9,21H.
What are the key properties of 3'-[3-(trifluoromethyl)phenyl]spiro[2-benzofuran-3,5'-2H-1,2-oxazole]-1-one?
3'-[3-(trifluoromethyl)phenyl]spiro[2-benzofuran-3,5'-2H-1,2-oxazole]-1-one has a molecular weight of 333.27 g/mol, XLogP of 3.60, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-[3-(trifluoromethyl)phenyl]spiro[2-benzofuran-3,5'-2H-1,2-oxazole]-1-one is sourced from PubChem (CID 57240150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).