About 2H-benzo[g]indole
2H-benzo[g]indole (PubChem CID 57240257) has the molecular formula C12H9N
and a molecular weight of 167.21 g/mol. Its IUPAC name is 2H-benzo[g]indole.
Molecular Properties
| Compound Name | 2H-benzo[g]indole |
| PubChem CID | 57240257 |
| Molecular Formula | C12H9N |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 2H-benzo[g]indole |
| SMILES | C1=c2ccc3ccccc3c2=NC1 |
| InChI | InChI=1S/C12H9N/c1-2-4-11-9(3-1)5-6-10-7-8-13-12(10)11/h1-7H,8H2 |
| InChIKey | KVNORWKQOUHKTD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2H-benzo[g]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-benzo[g]indole?
The IUPAC name of 2H-benzo[g]indole (CID 57240257) is 2H-benzo[g]indole.
What is the SMILES notation for 2H-benzo[g]indole?
The canonical SMILES for 2H-benzo[g]indole is C1=c2ccc3ccccc3c2=NC1.
What is the InChIKey of 2H-benzo[g]indole?
The InChIKey is KVNORWKQOUHKTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N/c1-2-4-11-9(3-1)5-6-10-7-8-13-12(10)11/h1-7H,8H2.
What are the key properties of 2H-benzo[g]indole?
2H-benzo[g]indole has a molecular weight of 167.21 g/mol, XLogP of 1.25, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-benzo[g]indole is sourced from PubChem (CID 57240257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).