About (5-iodo-3-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate
(5-iodo-3-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate (PubChem CID 57240635) has the molecular formula C15H17IN2O3
and a molecular weight of 400.22 g/mol. Its IUPAC name is (5-iodo-3-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate.
Molecular Properties
| Compound Name | (5-iodo-3-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate |
| PubChem CID | 57240635 |
| Molecular Formula | C15H17IN2O3 |
| Molecular Weight | 400.22 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | (5-iodo-3-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate |
| SMILES | CC(C)(Cn1cccc1)C(O)C(=O)Oc1cncc(I)c1 |
| InChI | InChI=1S/C15H17IN2O3/c1-15(2,10-18-5-3-4-6-18)13(19)14(20)21-12-7-11(16)8-17-9-12/h3-9,13,19H,10H2,1-2H3 |
| InChIKey | OWEGZMKAHVUKIL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (5-iodo-3-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-iodo-3-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate?
The IUPAC name of (5-iodo-3-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate (CID 57240635) is (5-iodo-3-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate.
What is the SMILES notation for (5-iodo-3-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate?
The canonical SMILES for (5-iodo-3-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate is CC(C)(Cn1cccc1)C(O)C(=O)Oc1cncc(I)c1.
What is the InChIKey of (5-iodo-3-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate?
The InChIKey is OWEGZMKAHVUKIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17IN2O3/c1-15(2,10-18-5-3-4-6-18)13(19)14(20)21-12-7-11(16)8-17-9-12/h3-9,13,19H,10H2,1-2H3.
What are the key properties of (5-iodo-3-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate?
(5-iodo-3-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate has a molecular weight of 400.22 g/mol, XLogP of 2.48, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-iodo-3-pyridinyl) 2-hydroxy-3,3-dimethyl-4-pyrrol-1-ylbutanoate is sourced from PubChem (CID 57240635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).