C28H48O5S2 — CID 57240879
2-[(6R,7S)-6-acetyloxy-7-[5,5-bis(ethylsulfanyl)-4,8-dimethylnon-7-enyl]-7-methyloxepan-3-ylidene]ethyl acetate (PubChem CID 57240879) has the molecular formula C28H48O5S2 and a molecular weight of 528.82 g/mol. Its IUPAC name is 2-[(6R,7S)-6-acetyloxy-7-[5,5-bis(ethylsulfanyl)-4,8-dimethylnon-7-enyl]-7-methyloxepan-3-ylidene]ethyl acetate.
| Compound Name | 2-[(6R,7S)-6-acetyloxy-7-[5,5-bis(ethylsulfanyl)-4,8-dimethylnon-7-enyl]-7-methyloxepan-3-ylidene]ethyl acetate |
|---|---|
| PubChem CID | 57240879 |
| Molecular Formula | C28H48O5S2 |
| Molecular Weight | 528.82 g/mol |
| Exact Mass | 528.29 |
| IUPAC Name | 2-[(6R,7S)-6-acetyloxy-7-[5,5-bis(ethylsulfanyl)-4,8-dimethylnon-7-enyl]-7-methyloxepan-3-ylidene]ethyl acetate |
| SMILES | CCSC(CC=C(C)C)(SCC)C(C)CCC[C@]1(C)OCC(=CCOC(C)=O)CC[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H48O5S2/c1-9-34-28(35-10-2,18-15-21(3)4)22(5)12-11-17-27(8)26(33-24(7)30)14-13-25(20-32-27)16-19-31-23(6)29/h15-16,22,26H,9-14,17-20H2,1-8H3/t22?,26-,27+/m1/s1 |
| InChIKey | FHPNVJFBQWNVAD-ISTZZABQSA-N |
| XLogP | 7.34 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.82 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|