C41H66O4 — CID 57241283
2,2,4-tris(3,7-dimethylocta-2,6-dienyl)-3,5-dihydroxy-6-(3-methylbutanoyl)cyclohexan-1-one (PubChem CID 57241283) has the molecular formula C41H66O4 and a molecular weight of 622.98 g/mol. Its IUPAC name is 2,2,4-tris(3,7-dimethylocta-2,6-dienyl)-3,5-dihydroxy-6-(3-methylbutanoyl)cyclohexan-1-one.
| Compound Name | 2,2,4-tris(3,7-dimethylocta-2,6-dienyl)-3,5-dihydroxy-6-(3-methylbutanoyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 57241283 |
| Molecular Formula | C41H66O4 |
| Molecular Weight | 622.98 g/mol |
| Exact Mass | 622.50 |
| IUPAC Name | 2,2,4-tris(3,7-dimethylocta-2,6-dienyl)-3,5-dihydroxy-6-(3-methylbutanoyl)cyclohexan-1-one |
| SMILES | CC(C)=CCCC(C)=CCC1C(O)C(C(=O)CC(C)C)C(=O)C(CC=C(C)CCC=C(C)C)(CC=C(C)CCC=C(C)C)C1O |
| InChI | InChI=1S/C41H66O4/c1-28(2)15-12-18-32(9)21-22-35-38(43)37(36(42)27-31(7)8)40(45)41(39(35)44,25-23-33(10)19-13-16-29(3)4)26-24-34(11)20-14-17-30(5)6/h15-17,21,23-24,31,35,37-39,43-44H,12-14,18-20,22,25-27H2,1-11H3 |
| InChIKey | QRUJGLHREOZWAH-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.98 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|