About ethyl [3-(4-methoxyphenyl)-1-[(2-methoxyphenyl)methyl]-[1]benzofuro[3,2-b]pyrrol-2-yl] carbonate
ethyl [3-(4-methoxyphenyl)-1-[(2-methoxyphenyl)methyl]-[1]benzofuro[3,2-b]pyrrol-2-yl] carbonate (PubChem CID 57241326) has the molecular formula C28H25NO6
and a molecular weight of 471.51 g/mol. Its IUPAC name is ethyl [3-(4-methoxyphenyl)-1-[(2-methoxyphenyl)methyl]-[1]benzofuro[3,2-b]pyrrol-2-yl] carbonate.
Molecular Properties
| Compound Name | ethyl [3-(4-methoxyphenyl)-1-[(2-methoxyphenyl)methyl]-[1]benzofuro[3,2-b]pyrrol-2-yl] carbonate |
| PubChem CID | 57241326 |
| Molecular Formula | C28H25NO6 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | ethyl [3-(4-methoxyphenyl)-1-[(2-methoxyphenyl)methyl]-[1]benzofuro[3,2-b]pyrrol-2-yl] carbonate |
| SMILES | CCOC(=O)Oc1c(-c2ccc(OC)cc2)c2oc3ccccc3c2n1Cc1ccccc1OC |
| InChI | InChI=1S/C28H25NO6/c1-4-33-28(30)35-27-24(18-13-15-20(31-2)16-14-18)26-25(21-10-6-8-12-23(21)34-26)29(27)17-19-9-5-7-11-22(19)32-3/h5-16H,4,17H2,1-3H3 |
| InChIKey | NXYUWHCKEAQFKX-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 72.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl [3-(4-methoxyphenyl)-1-[(2-methoxyphenyl)methyl]-[1]benzofuro[3,2-b]pyrrol-2-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl [3-(4-methoxyphenyl)-1-[(2-methoxyphenyl)methyl]-[1]benzofuro[3,2-b]pyrrol-2-yl] carbonate?
The IUPAC name of ethyl [3-(4-methoxyphenyl)-1-[(2-methoxyphenyl)methyl]-[1]benzofuro[3,2-b]pyrrol-2-yl] carbonate (CID 57241326) is ethyl [3-(4-methoxyphenyl)-1-[(2-methoxyphenyl)methyl]-[1]benzofuro[3,2-b]pyrrol-2-yl] carbonate.
What is the SMILES notation for ethyl [3-(4-methoxyphenyl)-1-[(2-methoxyphenyl)methyl]-[1]benzofuro[3,2-b]pyrrol-2-yl] carbonate?
The canonical SMILES for ethyl [3-(4-methoxyphenyl)-1-[(2-methoxyphenyl)methyl]-[1]benzofuro[3,2-b]pyrrol-2-yl] carbonate is CCOC(=O)Oc1c(-c2ccc(OC)cc2)c2oc3ccccc3c2n1Cc1ccccc1OC.
What is the InChIKey of ethyl [3-(4-methoxyphenyl)-1-[(2-methoxyphenyl)methyl]-[1]benzofuro[3,2-b]pyrrol-2-yl] carbonate?
The InChIKey is NXYUWHCKEAQFKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H25NO6/c1-4-33-28(30)35-27-24(18-13-15-20(31-2)16-14-18)26-25(21-10-6-8-12-23(21)34-26)29(27)17-19-9-5-7-11-22(19)32-3/h5-16H,4,17H2,1-3H3.
What are the key properties of ethyl [3-(4-methoxyphenyl)-1-[(2-methoxyphenyl)methyl]-[1]benzofuro[3,2-b]pyrrol-2-yl] carbonate?
ethyl [3-(4-methoxyphenyl)-1-[(2-methoxyphenyl)methyl]-[1]benzofuro[3,2-b]pyrrol-2-yl] carbonate has a molecular weight of 471.51 g/mol, XLogP of 6.66, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl [3-(4-methoxyphenyl)-1-[(2-methoxyphenyl)methyl]-[1]benzofuro[3,2-b]pyrrol-2-yl] carbonate is sourced from PubChem (CID 57241326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).