About benzyl azetidine-1-carboxylate
benzyl azetidine-1-carboxylate (PubChem CID 57241450) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is benzyl azetidine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl azetidine-1-carboxylate |
| PubChem CID | 57241450 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | benzyl azetidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC1 |
| InChI | InChI=1S/C11H13NO2/c13-11(12-7-4-8-12)14-9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2 |
| InChIKey | WXOQIRHYGZFGBS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzyl azetidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl azetidine-1-carboxylate?
The IUPAC name of benzyl azetidine-1-carboxylate (CID 57241450) is benzyl azetidine-1-carboxylate.
What is the SMILES notation for benzyl azetidine-1-carboxylate?
The canonical SMILES for benzyl azetidine-1-carboxylate is O=C(OCc1ccccc1)N1CCC1.
What is the InChIKey of benzyl azetidine-1-carboxylate?
The InChIKey is WXOQIRHYGZFGBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c13-11(12-7-4-8-12)14-9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2.
What are the key properties of benzyl azetidine-1-carboxylate?
benzyl azetidine-1-carboxylate has a molecular weight of 191.23 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl azetidine-1-carboxylate is sourced from PubChem (CID 57241450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).