About N-phenylmethoxy-3,4-dihydropyridin-5-amine
N-phenylmethoxy-3,4-dihydropyridin-5-amine (PubChem CID 57241534) has the molecular formula C12H14N2O
and a molecular weight of 202.26 g/mol. Its IUPAC name is N-phenylmethoxy-3,4-dihydropyridin-5-amine.
Molecular Properties
| Compound Name | N-phenylmethoxy-3,4-dihydropyridin-5-amine |
| PubChem CID | 57241534 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | N-phenylmethoxy-3,4-dihydropyridin-5-amine |
| SMILES | C1=NC=C(NOCc2ccccc2)CC1 |
| InChI | InChI=1S/C12H14N2O/c1-2-5-11(6-3-1)10-15-14-12-7-4-8-13-9-12/h1-3,5-6,8-9,14H,4,7,10H2 |
| InChIKey | HNAWHDRZBLXSES-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-phenylmethoxy-3,4-dihydropyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenylmethoxy-3,4-dihydropyridin-5-amine?
The IUPAC name of N-phenylmethoxy-3,4-dihydropyridin-5-amine (CID 57241534) is N-phenylmethoxy-3,4-dihydropyridin-5-amine.
What is the SMILES notation for N-phenylmethoxy-3,4-dihydropyridin-5-amine?
The canonical SMILES for N-phenylmethoxy-3,4-dihydropyridin-5-amine is C1=NC=C(NOCc2ccccc2)CC1.
What is the InChIKey of N-phenylmethoxy-3,4-dihydropyridin-5-amine?
The InChIKey is HNAWHDRZBLXSES-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O/c1-2-5-11(6-3-1)10-15-14-12-7-4-8-13-9-12/h1-3,5-6,8-9,14H,4,7,10H2.
What are the key properties of N-phenylmethoxy-3,4-dihydropyridin-5-amine?
N-phenylmethoxy-3,4-dihydropyridin-5-amine has a molecular weight of 202.26 g/mol, XLogP of 2.41, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylmethoxy-3,4-dihydropyridin-5-amine is sourced from PubChem (CID 57241534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).