C28H30F2N3O3P — CID 57241916
3-[3-[ethoxy(ethyl)phosphoryl]oxy-1,1-difluoropropyl]-1-trityl-1,2,4-triazole (PubChem CID 57241916) has the molecular formula C28H30F2N3O3P and a molecular weight of 525.54 g/mol. Its IUPAC name is 3-[3-[ethoxy(ethyl)phosphoryl]oxy-1,1-difluoropropyl]-1-trityl-1,2,4-triazole.
| Compound Name | 3-[3-[ethoxy(ethyl)phosphoryl]oxy-1,1-difluoropropyl]-1-trityl-1,2,4-triazole |
|---|---|
| PubChem CID | 57241916 |
| Molecular Formula | C28H30F2N3O3P |
| Molecular Weight | 525.54 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | 3-[3-[ethoxy(ethyl)phosphoryl]oxy-1,1-difluoropropyl]-1-trityl-1,2,4-triazole |
| SMILES | CCOP(=O)(CC)OCCC(F)(F)c1ncn(C(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C28H30F2N3O3P/c1-3-35-37(34,4-2)36-21-20-27(29,30)26-31-22-33(32-26)28(23-14-8-5-9-15-23,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-19,22H,3-4,20-21H2,1-2H3 |
| InChIKey | WITOUDITXIEJIN-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.54 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|