About 1,2,2-trifluoro-1-(1,2,2-trifluoropropoxy)propane
1,2,2-trifluoro-1-(1,2,2-trifluoropropoxy)propane (PubChem CID 57242034) has the molecular formula C6H8F6O
and a molecular weight of 210.12 g/mol. Its IUPAC name is 1,2,2-trifluoro-1-(1,2,2-trifluoropropoxy)propane.
Analyze 1,2,2-trifluoro-1-(1,2,2-trifluoropropoxy)propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,2-trifluoro-1-(1,2,2-trifluoropropoxy)propane?
The IUPAC name of 1,2,2-trifluoro-1-(1,2,2-trifluoropropoxy)propane (CID 57242034) is 1,2,2-trifluoro-1-(1,2,2-trifluoropropoxy)propane.
What is the SMILES notation for 1,2,2-trifluoro-1-(1,2,2-trifluoropropoxy)propane?
The canonical SMILES for 1,2,2-trifluoro-1-(1,2,2-trifluoropropoxy)propane is CC(F)(F)C(F)OC(F)C(C)(F)F.
What is the InChIKey of 1,2,2-trifluoro-1-(1,2,2-trifluoropropoxy)propane?
The InChIKey is NQEIWHUXRQXRCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F6O/c1-5(9,10)3(7)13-4(8)6(2,11)12/h3-4H,1-2H3.
What are the key properties of 1,2,2-trifluoro-1-(1,2,2-trifluoropropoxy)propane?
1,2,2-trifluoro-1-(1,2,2-trifluoropropoxy)propane has a molecular weight of 210.12 g/mol, XLogP of 2.90, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,2-trifluoro-1-(1,2,2-trifluoropropoxy)propane is sourced from PubChem (CID 57242034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).