C24H30N4O4 — CID 57242262
2-[[4-[(diaminomethylideneamino)methyl]cyclohexanecarbonyl]amino]-3-(3-phenoxyphenyl)propanoic acid (PubChem CID 57242262) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 2-[[4-[(diaminomethylideneamino)methyl]cyclohexanecarbonyl]amino]-3-(3-phenoxyphenyl)propanoic acid.
| Compound Name | 2-[[4-[(diaminomethylideneamino)methyl]cyclohexanecarbonyl]amino]-3-(3-phenoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 57242262 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 2-[[4-[(diaminomethylideneamino)methyl]cyclohexanecarbonyl]amino]-3-(3-phenoxyphenyl)propanoic acid |
| SMILES | NC(N)=NCC1CCC(C(=O)NC(Cc2cccc(Oc3ccccc3)c2)C(=O)O)CC1 |
| InChI | InChI=1S/C24H30N4O4/c25-24(26)27-15-16-9-11-18(12-10-16)22(29)28-21(23(30)31)14-17-5-4-8-20(13-17)32-19-6-2-1-3-7-19/h1-8,13,16,18,21H,9-12,14-15H2,(H,28,29)(H,30,31)(H4,25,26,27) |
| InChIKey | NCEOXXYBNCRXSV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|