About N-cyclohexyl-4,5-dihydro-2H-pyridin-3-imine
N-cyclohexyl-4,5-dihydro-2H-pyridin-3-imine (PubChem CID 57242536) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is N-cyclohexyl-4,5-dihydro-2H-pyridin-3-imine.
Molecular Properties
| Compound Name | N-cyclohexyl-4,5-dihydro-2H-pyridin-3-imine |
| PubChem CID | 57242536 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | N-cyclohexyl-4,5-dihydro-2H-pyridin-3-imine |
| SMILES | C1=NC/C(=N\C2CCCCC2)CC1 |
| InChI | InChI=1S/C11H18N2/c1-2-5-10(6-3-1)13-11-7-4-8-12-9-11/h8,10H,1-7,9H2/b13-11- |
| InChIKey | ZIPCSIMOQJLFBM-QBFSEMIESA-N |
| XLogP | 2.62 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexyl-4,5-dihydro-2H-pyridin-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-4,5-dihydro-2H-pyridin-3-imine?
The IUPAC name of N-cyclohexyl-4,5-dihydro-2H-pyridin-3-imine (CID 57242536) is N-cyclohexyl-4,5-dihydro-2H-pyridin-3-imine.
What is the SMILES notation for N-cyclohexyl-4,5-dihydro-2H-pyridin-3-imine?
The canonical SMILES for N-cyclohexyl-4,5-dihydro-2H-pyridin-3-imine is C1=NC/C(=N\C2CCCCC2)CC1.
What is the InChIKey of N-cyclohexyl-4,5-dihydro-2H-pyridin-3-imine?
The InChIKey is ZIPCSIMOQJLFBM-QBFSEMIESA-N. The full InChI is InChI=1S/C11H18N2/c1-2-5-10(6-3-1)13-11-7-4-8-12-9-11/h8,10H,1-7,9H2/b13-11-.
What are the key properties of N-cyclohexyl-4,5-dihydro-2H-pyridin-3-imine?
N-cyclohexyl-4,5-dihydro-2H-pyridin-3-imine has a molecular weight of 178.28 g/mol, XLogP of 2.62, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-4,5-dihydro-2H-pyridin-3-imine is sourced from PubChem (CID 57242536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).