C20H18ClNO3 — CID 57242894
9-[(2-chlorophenyl)methyl]-1-oxo-5,6,7,8-tetrahydro-4H-carbazole-2-carboxylic acid (PubChem CID 57242894) has the molecular formula C20H18ClNO3 and a molecular weight of 355.82 g/mol. Its IUPAC name is 9-[(2-chlorophenyl)methyl]-1-oxo-5,6,7,8-tetrahydro-4H-carbazole-2-carboxylic acid.
| Compound Name | 9-[(2-chlorophenyl)methyl]-1-oxo-5,6,7,8-tetrahydro-4H-carbazole-2-carboxylic acid |
|---|---|
| PubChem CID | 57242894 |
| Molecular Formula | C20H18ClNO3 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 9-[(2-chlorophenyl)methyl]-1-oxo-5,6,7,8-tetrahydro-4H-carbazole-2-carboxylic acid |
| SMILES | O=C(O)C1=CCc2c3c(n(Cc4ccccc4Cl)c2C1=O)CCCC3 |
| InChI | InChI=1S/C20H18ClNO3/c21-16-7-3-1-5-12(16)11-22-17-8-4-2-6-13(17)14-9-10-15(20(24)25)19(23)18(14)22/h1,3,5,7,10H,2,4,6,8-9,11H2,(H,24,25) |
| InChIKey | OJOPMCDRBYMVEA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|