C12H9F13O4 — CID 57243288
2-[[2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propoxy]methyl]oxirane (PubChem CID 57243288) has the molecular formula C12H9F13O4 and a molecular weight of 464.17 g/mol. Its IUPAC name is 2-[[2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propoxy]methyl]oxirane.
| Compound Name | 2-[[2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propoxy]methyl]oxirane |
|---|---|
| PubChem CID | 57243288 |
| Molecular Formula | C12H9F13O4 |
| Molecular Weight | 464.17 g/mol |
| Exact Mass | 464.03 |
| IUPAC Name | 2-[[2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propoxy]methyl]oxirane |
| SMILES | C=C(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(COCC1CO1)C(F)(F)F |
| InChI | InChI=1S/C12H9F13O4/c1-5(13)8(15,16)29-9(17,11(21,22)23)12(24,25)28-7(14,10(18,19)20)4-26-2-6-3-27-6/h6H,1-4H2 |
| InChIKey | SBXJVVJCTQAWKK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.17 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|