About (3,4-diphenyl-1,2-oxazol-5-yl) acetate
(3,4-diphenyl-1,2-oxazol-5-yl) acetate (PubChem CID 57243538) has the molecular formula C17H13NO3
and a molecular weight of 279.30 g/mol. Its IUPAC name is (3,4-diphenyl-1,2-oxazol-5-yl) acetate.
Molecular Properties
| Compound Name | (3,4-diphenyl-1,2-oxazol-5-yl) acetate |
| PubChem CID | 57243538 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | (3,4-diphenyl-1,2-oxazol-5-yl) acetate |
| SMILES | CC(=O)Oc1onc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C17H13NO3/c1-12(19)20-17-15(13-8-4-2-5-9-13)16(18-21-17)14-10-6-3-7-11-14/h2-11H,1H3 |
| InChIKey | QSIWRAYDYRRSQJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3,4-diphenyl-1,2-oxazol-5-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-diphenyl-1,2-oxazol-5-yl) acetate?
The IUPAC name of (3,4-diphenyl-1,2-oxazol-5-yl) acetate (CID 57243538) is (3,4-diphenyl-1,2-oxazol-5-yl) acetate.
What is the SMILES notation for (3,4-diphenyl-1,2-oxazol-5-yl) acetate?
The canonical SMILES for (3,4-diphenyl-1,2-oxazol-5-yl) acetate is CC(=O)Oc1onc(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of (3,4-diphenyl-1,2-oxazol-5-yl) acetate?
The InChIKey is QSIWRAYDYRRSQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO3/c1-12(19)20-17-15(13-8-4-2-5-9-13)16(18-21-17)14-10-6-3-7-11-14/h2-11H,1H3.
What are the key properties of (3,4-diphenyl-1,2-oxazol-5-yl) acetate?
(3,4-diphenyl-1,2-oxazol-5-yl) acetate has a molecular weight of 279.30 g/mol, XLogP of 3.93, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-diphenyl-1,2-oxazol-5-yl) acetate is sourced from PubChem (CID 57243538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).