C34H38ClNO8S — CID 57243703
N-[3-[2-[2-(4-chlorophenyl)sulfanylethoxy]-3-methoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]prop-1-ynyl]-N-hydroxypropanamide (PubChem CID 57243703) has the molecular formula C34H38ClNO8S and a molecular weight of 656.20 g/mol. Its IUPAC name is N-[3-[2-[2-(4-chlorophenyl)sulfanylethoxy]-3-methoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]prop-1-ynyl]-N-hydroxypropanamide.
| Compound Name | N-[3-[2-[2-(4-chlorophenyl)sulfanylethoxy]-3-methoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]prop-1-ynyl]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 57243703 |
| Molecular Formula | C34H38ClNO8S |
| Molecular Weight | 656.20 g/mol |
| Exact Mass | 655.20 |
| IUPAC Name | N-[3-[2-[2-(4-chlorophenyl)sulfanylethoxy]-3-methoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]prop-1-ynyl]-N-hydroxypropanamide |
| SMILES | CCC(=O)N(O)C#CCc1cc(C2CCC(c3cc(OC)c(OC)c(OC)c3)O2)cc(OC)c1OCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C34H38ClNO8S/c1-6-32(37)36(38)15-7-8-22-18-23(19-29(39-2)33(22)43-16-17-45-26-11-9-25(35)10-12-26)27-13-14-28(44-27)24-20-30(40-3)34(42-5)31(21-24)41-4/h9-12,18-21,27-28,38H,6,8,13-14,16-17H2,1-5H3 |
| InChIKey | NNZAAMFCFMNHIF-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.20 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|