C19H16N4O4S — CID 57244101
4-[1-[5-(1,3-oxazol-5-yl)-2-oxo-1,3-dihydroindol-3-yl]ethylideneamino]benzenesulfonamide (PubChem CID 57244101) has the molecular formula C19H16N4O4S and a molecular weight of 396.43 g/mol. Its IUPAC name is 4-[1-[5-(1,3-oxazol-5-yl)-2-oxo-1,3-dihydroindol-3-yl]ethylideneamino]benzenesulfonamide.
| Compound Name | 4-[1-[5-(1,3-oxazol-5-yl)-2-oxo-1,3-dihydroindol-3-yl]ethylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 57244101 |
| Molecular Formula | C19H16N4O4S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 4-[1-[5-(1,3-oxazol-5-yl)-2-oxo-1,3-dihydroindol-3-yl]ethylideneamino]benzenesulfonamide |
| SMILES | C/C(=N\c1ccc(S(N)(=O)=O)cc1)C1C(=O)Nc2ccc(-c3cnco3)cc21 |
| InChI | InChI=1S/C19H16N4O4S/c1-11(22-13-3-5-14(6-4-13)28(20,25)26)18-15-8-12(17-9-21-10-27-17)2-7-16(15)23-19(18)24/h2-10,18H,1H3,(H,23,24)(H2,20,25,26)/b22-11+ |
| InChIKey | OPLHNOVRWYFVGR-SSDVNMTOSA-N |
| XLogP | 2.82 |
| TPSA | 127.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|