About 3-iminononan-1-amine
3-iminononan-1-amine (PubChem CID 57244141) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is 3-iminononan-1-amine.
Molecular Properties
| Compound Name | 3-iminononan-1-amine |
| PubChem CID | 57244141 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 3-iminononan-1-amine |
| SMILES | [H]/N=C(\CCN)CCCCCC |
| InChI | InChI=1S/C9H20N2/c1-2-3-4-5-6-9(11)7-8-10/h11H,2-8,10H2,1H3/b11-9- |
| InChIKey | ZDUPLAHSALYIPY-LUAWRHEFSA-N |
| XLogP | 2.33 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-iminononan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iminononan-1-amine?
The IUPAC name of 3-iminononan-1-amine (CID 57244141) is 3-iminononan-1-amine.
What is the SMILES notation for 3-iminononan-1-amine?
The canonical SMILES for 3-iminononan-1-amine is [H]/N=C(\CCN)CCCCCC.
What is the InChIKey of 3-iminononan-1-amine?
The InChIKey is ZDUPLAHSALYIPY-LUAWRHEFSA-N. The full InChI is InChI=1S/C9H20N2/c1-2-3-4-5-6-9(11)7-8-10/h11H,2-8,10H2,1H3/b11-9-.
What are the key properties of 3-iminononan-1-amine?
3-iminononan-1-amine has a molecular weight of 156.27 g/mol, XLogP of 2.33, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iminononan-1-amine is sourced from PubChem (CID 57244141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).