C41H51FO5S — CID 57244186
3-[2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]oxypropyl octadeca-6,9,12-trienoate (PubChem CID 57244186) has the molecular formula C41H51FO5S and a molecular weight of 674.92 g/mol. Its IUPAC name is 3-[2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]oxypropyl octadeca-6,9,12-trienoate.
| Compound Name | 3-[2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]oxypropyl octadeca-6,9,12-trienoate |
|---|---|
| PubChem CID | 57244186 |
| Molecular Formula | C41H51FO5S |
| Molecular Weight | 674.92 g/mol |
| Exact Mass | 674.34 |
| IUPAC Name | 3-[2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methylidene]inden-1-yl]acetyl]oxypropyl octadeca-6,9,12-trienoate |
| SMILES | CCCCCC=CCC=CCC=CCCCCC(=O)OCCCOC(=O)CC1=C(C)C(=Cc2ccc(S(C)=O)cc2)c2ccc(F)cc21 |
| InChI | InChI=1S/C41H51FO5S/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-40(43)46-27-19-28-47-41(44)31-38-32(2)37(36-26-23-34(42)30-39(36)38)29-33-21-24-35(25-22-33)48(3)45/h8-9,11-12,14-15,21-26,29-30H,4-7,10,13,16-20,27-28,31H2,1-3H3 |
| InChIKey | NSOKELFHWKERIO-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.92 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|