C11H13ClN4OS — CID 57244668
1-amino-3-[[3-(4-chlorophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methyl]thiourea (PubChem CID 57244668) has the molecular formula C11H13ClN4OS and a molecular weight of 284.77 g/mol. Its IUPAC name is 1-amino-3-[[3-(4-chlorophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methyl]thiourea.
| Compound Name | 1-amino-3-[[3-(4-chlorophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methyl]thiourea |
|---|---|
| PubChem CID | 57244668 |
| Molecular Formula | C11H13ClN4OS |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 1-amino-3-[[3-(4-chlorophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methyl]thiourea |
| SMILES | NNC(=S)NCC1C=C(c2ccc(Cl)cc2)NO1 |
| InChI | InChI=1S/C11H13ClN4OS/c12-8-3-1-7(2-4-8)10-5-9(17-16-10)6-14-11(18)15-13/h1-5,9,16H,6,13H2,(H2,14,15,18) |
| InChIKey | LOWRZLSFFSESNI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|