C25H28F2N4O4S — CID 57245047
N-[5-(4,4-difluorocyclohexyl)-3-hydroxy-6-(hydroxyamino)-6-oxo-1-thiophen-2-ylhexan-2-yl]quinoxaline-2-carboxamide (PubChem CID 57245047) has the molecular formula C25H28F2N4O4S and a molecular weight of 518.59 g/mol. Its IUPAC name is N-[5-(4,4-difluorocyclohexyl)-3-hydroxy-6-(hydroxyamino)-6-oxo-1-thiophen-2-ylhexan-2-yl]quinoxaline-2-carboxamide.
| Compound Name | N-[5-(4,4-difluorocyclohexyl)-3-hydroxy-6-(hydroxyamino)-6-oxo-1-thiophen-2-ylhexan-2-yl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 57245047 |
| Molecular Formula | C25H28F2N4O4S |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | N-[5-(4,4-difluorocyclohexyl)-3-hydroxy-6-(hydroxyamino)-6-oxo-1-thiophen-2-ylhexan-2-yl]quinoxaline-2-carboxamide |
| SMILES | O=C(NC(Cc1cccs1)C(O)CC(C(=O)NO)C1CCC(F)(F)CC1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C25H28F2N4O4S/c26-25(27)9-7-15(8-10-25)17(23(33)31-35)13-22(32)20(12-16-4-3-11-36-16)30-24(34)21-14-28-18-5-1-2-6-19(18)29-21/h1-6,11,14-15,17,20,22,32,35H,7-10,12-13H2,(H,30,34)(H,31,33) |
| InChIKey | PQCPQKIFWWAXGZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|