About 1-methyl-2,4-dihydropyridin-3-imine
1-methyl-2,4-dihydropyridin-3-imine (PubChem CID 57245082) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is 1-methyl-2,4-dihydropyridin-3-imine.
Molecular Properties
| Compound Name | 1-methyl-2,4-dihydropyridin-3-imine |
| PubChem CID | 57245082 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | 1-methyl-2,4-dihydropyridin-3-imine |
| SMILES | [H]/N=C1\CC=CN(C)C1 |
| InChI | InChI=1S/C6H10N2/c1-8-4-2-3-6(7)5-8/h2,4,7H,3,5H2,1H3/b7-6+ |
| InChIKey | PPXSELHNBZXOBC-VOTSOKGWSA-N |
| XLogP | 0.86 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2,4-dihydropyridin-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,4-dihydropyridin-3-imine?
The IUPAC name of 1-methyl-2,4-dihydropyridin-3-imine (CID 57245082) is 1-methyl-2,4-dihydropyridin-3-imine.
What is the SMILES notation for 1-methyl-2,4-dihydropyridin-3-imine?
The canonical SMILES for 1-methyl-2,4-dihydropyridin-3-imine is [H]/N=C1\CC=CN(C)C1.
What is the InChIKey of 1-methyl-2,4-dihydropyridin-3-imine?
The InChIKey is PPXSELHNBZXOBC-VOTSOKGWSA-N. The full InChI is InChI=1S/C6H10N2/c1-8-4-2-3-6(7)5-8/h2,4,7H,3,5H2,1H3/b7-6+.
What are the key properties of 1-methyl-2,4-dihydropyridin-3-imine?
1-methyl-2,4-dihydropyridin-3-imine has a molecular weight of 110.16 g/mol, XLogP of 0.86, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,4-dihydropyridin-3-imine is sourced from PubChem (CID 57245082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).