C22H24N2O4 — CID 57245363
4-hydroxy-N-[(3-methoxyphenyl)methyl]-6-methyl-2-oxo-1-propan-2-ylquinoline-3-carboxamide (PubChem CID 57245363) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 4-hydroxy-N-[(3-methoxyphenyl)methyl]-6-methyl-2-oxo-1-propan-2-ylquinoline-3-carboxamide.
| Compound Name | 4-hydroxy-N-[(3-methoxyphenyl)methyl]-6-methyl-2-oxo-1-propan-2-ylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 57245363 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 4-hydroxy-N-[(3-methoxyphenyl)methyl]-6-methyl-2-oxo-1-propan-2-ylquinoline-3-carboxamide |
| SMILES | COc1cccc(CNC(=O)c2c(O)c3cc(C)ccc3n(C(C)C)c2=O)c1 |
| InChI | InChI=1S/C22H24N2O4/c1-13(2)24-18-9-8-14(3)10-17(18)20(25)19(22(24)27)21(26)23-12-15-6-5-7-16(11-15)28-4/h5-11,13,25H,12H2,1-4H3,(H,23,26) |
| InChIKey | BZYDADBIUHZPOJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |