About CID 57245472
CID 57245472 (PubChem CID 57245472) has the molecular formula C8H6BN4O2
and a molecular weight of 200.97 g/mol.
Molecular Properties
| Compound Name | CID 57245472 |
| PubChem CID | 57245472 |
| Molecular Formula | C8H6BN4O2 |
| Molecular Weight | 200.97 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | — |
| SMILES | [B](Oc1cncnc1)Oc1cncnc1 |
| InChI | InChI=1S/C8H6BN4O2/c1-7(2-11-5-10-1)14-9-15-8-3-12-6-13-4-8/h1-6H |
| InChIKey | UJPVLQHTSFWRTC-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.97 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 57245472 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57245472?
The IUPAC name of CID 57245472 (CID 57245472) is not available.
What is the SMILES notation for CID 57245472?
The canonical SMILES for CID 57245472 is [B](Oc1cncnc1)Oc1cncnc1.
What is the InChIKey of CID 57245472?
The InChIKey is UJPVLQHTSFWRTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BN4O2/c1-7(2-11-5-10-1)14-9-15-8-3-12-6-13-4-8/h1-6H.
What are the key properties of CID 57245472?
CID 57245472 has a molecular weight of 200.97 g/mol, XLogP of 0.26, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57245472 is sourced from PubChem (CID 57245472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).