C6H6Cl2F6O — CID 57245569
1-chloro-3-(3-chloro-2,2,3-trifluoropropoxy)-1,2,2-trifluoropropane (PubChem CID 57245569) has the molecular formula C6H6Cl2F6O and a molecular weight of 279.01 g/mol. Its IUPAC name is 1-chloro-3-(3-chloro-2,2,3-trifluoropropoxy)-1,2,2-trifluoropropane.
| Compound Name | 1-chloro-3-(3-chloro-2,2,3-trifluoropropoxy)-1,2,2-trifluoropropane |
|---|---|
| PubChem CID | 57245569 |
| Molecular Formula | C6H6Cl2F6O |
| Molecular Weight | 279.01 g/mol |
| Exact Mass | 277.97 |
| IUPAC Name | 1-chloro-3-(3-chloro-2,2,3-trifluoropropoxy)-1,2,2-trifluoropropane |
| SMILES | FC(Cl)C(F)(F)COCC(F)(F)C(F)Cl |
| InChI | InChI=1S/C6H6Cl2F6O/c7-3(9)5(11,12)1-15-2-6(13,14)4(8)10/h3-4H,1-2H2 |
| InChIKey | VGALRTWXBWUFRZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.01 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|