C15H27NO2 — CID 57245572
1-(5-hydroxy-7-pentyl-1,2,3,5,6,7,8,8a-octahydroindolizin-2-yl)ethanone (PubChem CID 57245572) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 1-(5-hydroxy-7-pentyl-1,2,3,5,6,7,8,8a-octahydroindolizin-2-yl)ethanone.
| Compound Name | 1-(5-hydroxy-7-pentyl-1,2,3,5,6,7,8,8a-octahydroindolizin-2-yl)ethanone |
|---|---|
| PubChem CID | 57245572 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 1-(5-hydroxy-7-pentyl-1,2,3,5,6,7,8,8a-octahydroindolizin-2-yl)ethanone |
| SMILES | CCCCCC1CC(O)N2CC(C(C)=O)CC2C1 |
| InChI | InChI=1S/C15H27NO2/c1-3-4-5-6-12-7-14-9-13(11(2)17)10-16(14)15(18)8-12/h12-15,18H,3-10H2,1-2H3 |
| InChIKey | BGNYPWHCSICDDW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|