About 1,5-dibromo-1-(1,5-dibromopentoxy)pentane
1,5-dibromo-1-(1,5-dibromopentoxy)pentane (PubChem CID 57245607) has the molecular formula C10H18Br4O
and a molecular weight of 473.87 g/mol. Its IUPAC name is 1,5-dibromo-1-(1,5-dibromopentoxy)pentane.
Molecular Properties
| Compound Name | 1,5-dibromo-1-(1,5-dibromopentoxy)pentane |
| PubChem CID | 57245607 |
| Molecular Formula | C10H18Br4O |
| Molecular Weight | 473.87 g/mol |
| Exact Mass | 469.81 |
| IUPAC Name | 1,5-dibromo-1-(1,5-dibromopentoxy)pentane |
| SMILES | BrCCCCC(Br)OC(Br)CCCCBr |
| InChI | InChI=1S/C10H18Br4O/c11-7-3-1-5-9(13)15-10(14)6-2-4-8-12/h9-10H,1-8H2 |
| InChIKey | FBCCHTNMTOHAQH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.87 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dibromo-1-(1,5-dibromopentoxy)pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dibromo-1-(1,5-dibromopentoxy)pentane?
The IUPAC name of 1,5-dibromo-1-(1,5-dibromopentoxy)pentane (CID 57245607) is 1,5-dibromo-1-(1,5-dibromopentoxy)pentane.
What is the SMILES notation for 1,5-dibromo-1-(1,5-dibromopentoxy)pentane?
The canonical SMILES for 1,5-dibromo-1-(1,5-dibromopentoxy)pentane is BrCCCCC(Br)OC(Br)CCCCBr.
What is the InChIKey of 1,5-dibromo-1-(1,5-dibromopentoxy)pentane?
The InChIKey is FBCCHTNMTOHAQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18Br4O/c11-7-3-1-5-9(13)15-10(14)6-2-4-8-12/h9-10H,1-8H2.
What are the key properties of 1,5-dibromo-1-(1,5-dibromopentoxy)pentane?
1,5-dibromo-1-(1,5-dibromopentoxy)pentane has a molecular weight of 473.87 g/mol, XLogP of 5.58, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dibromo-1-(1,5-dibromopentoxy)pentane is sourced from PubChem (CID 57245607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).