About methyl imidazo[1,5-a]pyridine-1-carboxylate
methyl imidazo[1,5-a]pyridine-1-carboxylate (PubChem CID 57245894) has the molecular formula C9H8N2O2
and a molecular weight of 176.17 g/mol. Its IUPAC name is methyl imidazo[1,5-a]pyridine-1-carboxylate.
Molecular Properties
| Compound Name | methyl imidazo[1,5-a]pyridine-1-carboxylate |
| PubChem CID | 57245894 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | methyl imidazo[1,5-a]pyridine-1-carboxylate |
| SMILES | COC(=O)c1ncn2ccccc12 |
| InChI | InChI=1S/C9H8N2O2/c1-13-9(12)8-7-4-2-3-5-11(7)6-10-8/h2-6H,1H3 |
| InChIKey | JAHBFRLRXFGDFD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl imidazo[1,5-a]pyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl imidazo[1,5-a]pyridine-1-carboxylate?
The IUPAC name of methyl imidazo[1,5-a]pyridine-1-carboxylate (CID 57245894) is methyl imidazo[1,5-a]pyridine-1-carboxylate.
What is the SMILES notation for methyl imidazo[1,5-a]pyridine-1-carboxylate?
The canonical SMILES for methyl imidazo[1,5-a]pyridine-1-carboxylate is COC(=O)c1ncn2ccccc12.
What is the InChIKey of methyl imidazo[1,5-a]pyridine-1-carboxylate?
The InChIKey is JAHBFRLRXFGDFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c1-13-9(12)8-7-4-2-3-5-11(7)6-10-8/h2-6H,1H3.
What are the key properties of methyl imidazo[1,5-a]pyridine-1-carboxylate?
methyl imidazo[1,5-a]pyridine-1-carboxylate has a molecular weight of 176.17 g/mol, XLogP of 1.12, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl imidazo[1,5-a]pyridine-1-carboxylate is sourced from PubChem (CID 57245894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).