C24H38N2O6 — CID 57245934
ditert-butyl (4R,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-prop-2-ynoylpyrrolidine-1,2-dicarboxylate (PubChem CID 57245934) has the molecular formula C24H38N2O6 and a molecular weight of 450.58 g/mol. Its IUPAC name is ditert-butyl (4R,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-prop-2-ynoylpyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (4R,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-prop-2-ynoylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 57245934 |
| Molecular Formula | C24H38N2O6 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | ditert-butyl (4R,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-prop-2-ynoylpyrrolidine-1,2-dicarboxylate |
| SMILES | C#CC(=O)[C@@H]1CC(C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)[C@H]1[C@H](CC(C)C)NC(C)=O |
| InChI | InChI=1S/C24H38N2O6/c1-11-19(28)16-13-18(21(29)31-23(5,6)7)26(22(30)32-24(8,9)10)20(16)17(12-14(2)3)25-15(4)27/h1,14,16-18,20H,12-13H2,2-10H3,(H,25,27)/t16-,17-,18?,20+/m0/s1 |
| InChIKey | VLSARYZPKIRCRP-DCAMYXFASA-N |
| XLogP | 3.08 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|