About 1-(3,3-dimethylpent-1-enoxy)-3,3-dimethylpent-1-ene
1-(3,3-dimethylpent-1-enoxy)-3,3-dimethylpent-1-ene (PubChem CID 57246354) has the molecular formula C14H26O
and a molecular weight of 210.36 g/mol. Its IUPAC name is 1-(3,3-dimethylpent-1-enoxy)-3,3-dimethylpent-1-ene.
Molecular Properties
| Compound Name | 1-(3,3-dimethylpent-1-enoxy)-3,3-dimethylpent-1-ene |
| PubChem CID | 57246354 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 1-(3,3-dimethylpent-1-enoxy)-3,3-dimethylpent-1-ene |
| SMILES | CCC(C)(C)C=COC=CC(C)(C)CC |
| InChI | InChI=1S/C14H26O/c1-7-13(3,4)9-11-15-12-10-14(5,6)8-2/h9-12H,7-8H2,1-6H3 |
| InChIKey | MEZPSSOGCCSPMH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-dimethylpent-1-enoxy)-3,3-dimethylpent-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethylpent-1-enoxy)-3,3-dimethylpent-1-ene?
The IUPAC name of 1-(3,3-dimethylpent-1-enoxy)-3,3-dimethylpent-1-ene (CID 57246354) is 1-(3,3-dimethylpent-1-enoxy)-3,3-dimethylpent-1-ene.
What is the SMILES notation for 1-(3,3-dimethylpent-1-enoxy)-3,3-dimethylpent-1-ene?
The canonical SMILES for 1-(3,3-dimethylpent-1-enoxy)-3,3-dimethylpent-1-ene is CCC(C)(C)C=COC=CC(C)(C)CC.
What is the InChIKey of 1-(3,3-dimethylpent-1-enoxy)-3,3-dimethylpent-1-ene?
The InChIKey is MEZPSSOGCCSPMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O/c1-7-13(3,4)9-11-15-12-10-14(5,6)8-2/h9-12H,7-8H2,1-6H3.
What are the key properties of 1-(3,3-dimethylpent-1-enoxy)-3,3-dimethylpent-1-ene?
1-(3,3-dimethylpent-1-enoxy)-3,3-dimethylpent-1-ene has a molecular weight of 210.36 g/mol, XLogP of 4.90, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethylpent-1-enoxy)-3,3-dimethylpent-1-ene is sourced from PubChem (CID 57246354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).