About 1,3-bis[2-(2-methoxyethoxy)ethyl]-4,5-dihydroimidazol-1-ium
1,3-bis[2-(2-methoxyethoxy)ethyl]-4,5-dihydroimidazol-1-ium (PubChem CID 57246999) has the molecular formula C13H27N2O4+
and a molecular weight of 275.37 g/mol. Its IUPAC name is 1,3-bis[2-(2-methoxyethoxy)ethyl]-4,5-dihydroimidazol-1-ium.
Molecular Properties
| Compound Name | 1,3-bis[2-(2-methoxyethoxy)ethyl]-4,5-dihydroimidazol-1-ium |
| PubChem CID | 57246999 |
| Molecular Formula | C13H27N2O4+ |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 1,3-bis[2-(2-methoxyethoxy)ethyl]-4,5-dihydroimidazol-1-ium |
| SMILES | COCCOCCN1C=[N+](CCOCCOC)CC1 |
| InChI | InChI=1S/C13H27N2O4/c1-16-9-11-18-7-5-14-3-4-15(13-14)6-8-19-12-10-17-2/h13H,3-12H2,1-2H3/q+1 |
| InChIKey | QHYROMZSTGXAOS-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 43.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis[2-(2-methoxyethoxy)ethyl]-4,5-dihydroimidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis[2-(2-methoxyethoxy)ethyl]-4,5-dihydroimidazol-1-ium?
The IUPAC name of 1,3-bis[2-(2-methoxyethoxy)ethyl]-4,5-dihydroimidazol-1-ium (CID 57246999) is 1,3-bis[2-(2-methoxyethoxy)ethyl]-4,5-dihydroimidazol-1-ium.
What is the SMILES notation for 1,3-bis[2-(2-methoxyethoxy)ethyl]-4,5-dihydroimidazol-1-ium?
The canonical SMILES for 1,3-bis[2-(2-methoxyethoxy)ethyl]-4,5-dihydroimidazol-1-ium is COCCOCCN1C=[N+](CCOCCOC)CC1.
What is the InChIKey of 1,3-bis[2-(2-methoxyethoxy)ethyl]-4,5-dihydroimidazol-1-ium?
The InChIKey is QHYROMZSTGXAOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N2O4/c1-16-9-11-18-7-5-14-3-4-15(13-14)6-8-19-12-10-17-2/h13H,3-12H2,1-2H3/q+1.
What are the key properties of 1,3-bis[2-(2-methoxyethoxy)ethyl]-4,5-dihydroimidazol-1-ium?
1,3-bis[2-(2-methoxyethoxy)ethyl]-4,5-dihydroimidazol-1-ium has a molecular weight of 275.37 g/mol, XLogP of -0.33, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis[2-(2-methoxyethoxy)ethyl]-4,5-dihydroimidazol-1-ium is sourced from PubChem (CID 57246999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).