C38H68N2O4Si2 — CID 57247130
[tert-butyl(dimethyl)silyl] 5-[(3S,4aR,8aR)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-benzyl-4-[tert-butyl(dimethyl)silyl]oxypentanoate (PubChem CID 57247130) has the molecular formula C38H68N2O4Si2 and a molecular weight of 673.14 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 5-[(3S,4aR,8aR)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-benzyl-4-[tert-butyl(dimethyl)silyl]oxypentanoate.
| Compound Name | [tert-butyl(dimethyl)silyl] 5-[(3S,4aR,8aR)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-benzyl-4-[tert-butyl(dimethyl)silyl]oxypentanoate |
|---|---|
| PubChem CID | 57247130 |
| Molecular Formula | C38H68N2O4Si2 |
| Molecular Weight | 673.14 g/mol |
| Exact Mass | 672.47 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 5-[(3S,4aR,8aR)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-benzyl-4-[tert-butyl(dimethyl)silyl]oxypentanoate |
| SMILES | CC(C)(C)NC(=O)[C@@H]1C[C@H]2CCCC[C@H]2CN1CC(CC(Cc1ccccc1)C(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H68N2O4Si2/c1-36(2,3)39-34(41)33-25-29-21-17-18-22-30(29)26-40(33)27-32(43-45(10,11)37(4,5)6)24-31(23-28-19-15-14-16-20-28)35(42)44-46(12,13)38(7,8)9/h14-16,19-20,29-33H,17-18,21-27H2,1-13H3,(H,39,41)/t29-,30+,31?,32?,33+/m1/s1 |
| InChIKey | YVQHOYWVSJWOST-VFAOVOSDSA-N |
| XLogP | 8.97 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.14 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|